cas: 960298-00-4 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-4-bromopyridine, 97%, 97% (CAS 960298-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117TJ2-1g |
| cas | 960298-00-4 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 4029.20 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 549.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-phenylmethoxypyridine (CAS 960298-00-4) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 4-bromo-2-phenylmethoxypyridine. InChIKey: ZBTZIRNIUHLSSJ-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 4-bromo-2-phenylmethoxypyridine |
| InChIKey | ZBTZIRNIUHLSSJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)