CAS 1119089-23-4 is the registry number for 5-Bromo-2-(3-methoxyphenyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-bromo-2-(3-methoxyphenyl)pyridine (CAS 1119089-23-4) is a chemical compound with the molecular formula C12H10BrNO and a molecular weight of 264.12 g/mol. IUPAC name: 5-bromo-2-(3-methoxyphenyl)pyridine. InChIKey: DTTWWGLYRMBSGR-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO |
|---|---|
| Molecular weight | 264.12 g/mol |
| IUPAC name | 5-bromo-2-(3-methoxyphenyl)pyridine |
| InChIKey | DTTWWGLYRMBSGR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)