cas: 1218791-34-4 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine 96% (CAS 1218791-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A703463-100mg |
| cas | 1218791-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A703463 |
2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1218791-34-4) is a chemical compound with the molecular formula C17H21BN2O3 and a molecular weight of 312.2 g/mol. IUPAC name: 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: QEAOMIPVGHEIFT-UHFFFAOYSA-N.
| Molecular formula | C17H21BN2O3 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | QEAOMIPVGHEIFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)