cas: 1218791-34-4 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine, 96%, 96% (CAS 1218791-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127BM-100mg |
| cas | 1218791-34-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1878.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1218791-34-4) is a chemical compound with the molecular formula C17H21BN2O3 and a molecular weight of 312.2 g/mol. IUPAC name: 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: QEAOMIPVGHEIFT-UHFFFAOYSA-N.
| Molecular formula | C17H21BN2O3 |
|---|---|
| Molecular weight | 312.2 g/mol |
| IUPAC name | 2-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | QEAOMIPVGHEIFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)