cas: 742058-39-5 — see every product listed under this CAS number, including other names
2-(Benzyloxy)-5-bromopyrimidine 98% (CAS 742058-39-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A489793-1g |
| cas | 742058-39-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 698.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A489793 |
5-bromo-2-phenylmethoxypyrimidine (CAS 742058-39-5) is a chemical compound with the molecular formula C11H9BrN2O and a molecular weight of 265.11 g/mol. IUPAC name: 5-bromo-2-phenylmethoxypyrimidine. InChIKey: RDGZEALFIOPSCC-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O |
|---|---|
| Molecular weight | 265.11 g/mol |
| IUPAC name | 5-bromo-2-phenylmethoxypyrimidine |
| InChIKey | RDGZEALFIOPSCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)