cas: 79686-18-3 — see every product listed under this CAS number, including other names
2-(Benzylthio)-5-bromopyrimidine, >97%, >97% (CAS 79686-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119LND-1g |
| cas | 79686-18-3 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 5g | 4422.80 Pln | |
| Chemat | 10g | 6885.20 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-benzylsulfanyl-5-bromopyrimidine (CAS 79686-18-3) is a chemical compound with the molecular formula C11H9BrN2S and a molecular weight of 281.17 g/mol. IUPAC name: 2-benzylsulfanyl-5-bromopyrimidine. InChIKey: LXOANVAJTYXINB-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2S |
|---|---|
| Molecular weight | 281.17 g/mol |
| IUPAC name | 2-benzylsulfanyl-5-bromopyrimidine |
| InChIKey | LXOANVAJTYXINB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)