CAS 35181-52-3 is the registry number for 6-(4-Bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole (CAS 35181-52-3) is a chemical compound with the molecular formula C11H9BrN2S and a molecular weight of 281.17 g/mol. IUPAC name: 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole. InChIKey: GPJBSEDJRPMPHS-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2S |
|---|---|
| Molecular weight | 281.17 g/mol |
| IUPAC name | 6-(4-bromophenyl)-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
| InChIKey | GPJBSEDJRPMPHS-UHFFFAOYSA-N |
| SMILES | C1CSC2=NC(=CN21)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)