cas: 1227502-50-2 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-3-chloro-5-(trifluoromethyl)pyridine 95% (CAS 1227502-50-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A751024-100mg |
| cas | 1227502-50-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1366.06 Pln | |
| Ambeed | 5g | 3902.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A751024 |
2-(bromomethyl)-3-chloro-5-(trifluoromethyl)pyridine (CAS 1227502-50-2) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 2-(bromomethyl)-3-chloro-5-(trifluoromethyl)pyridine. InChIKey: WPALGCBMYXXOSU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 2-(bromomethyl)-3-chloro-5-(trifluoromethyl)pyridine |
| InChIKey | WPALGCBMYXXOSU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CBr)C(F)(F)F |
Computed by PubChem (NCBI)