CAS 104460-69-7 appears in our catalog under these names: 4-bromo-2-chloro-5-(trifluoromethyl)aniline, 95%, 5-Amino-2-bromo-4-chlorobenzotrifluoride. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
4-bromo-2-chloro-5-(trifluoromethyl)aniline (CAS 104460-69-7) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-(trifluoromethyl)aniline. InChIKey: LPTLQQLBRJFBIN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-(trifluoromethyl)aniline |
| InChIKey | LPTLQQLBRJFBIN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)