cas: 1030832-39-3 — see every product listed under this CAS number, including other names
2-(Bromomethyl)-5-fluorophenylboronic acid, pinacol ester, 96%, 96% (CAS 1030832-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118I46-250mg |
| cas | 1030832-39-3 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[2-(bromomethyl)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1030832-39-3) is a chemical compound with the molecular formula C13H17BBrFO2 and a molecular weight of 314.99 g/mol. IUPAC name: 2-[2-(bromomethyl)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YAYDJVPPMDALER-UHFFFAOYSA-N.
| Molecular formula | C13H17BBrFO2 |
|---|---|
| Molecular weight | 314.99 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-5-fluorophenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YAYDJVPPMDALER-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)CBr |
Computed by PubChem (NCBI)