cas: 849094-03-7 — see every product listed under this CAS number, including other names
2-(Chloromethyl)-6-(trifluoromethyl)pyridine 95+% (CAS 849094-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A530375-100mg |
| cas | 849094-03-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A530375 |
2-(chloromethyl)-6-(trifluoromethyl)pyridine (CAS 849094-03-7) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 2-(chloromethyl)-6-(trifluoromethyl)pyridine. InChIKey: IZCYKFUHFBLPJN-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 2-(chloromethyl)-6-(trifluoromethyl)pyridine |
| InChIKey | IZCYKFUHFBLPJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)