CAS 1099597-74-6 is the registry number for 2-Chloro-6-methyl-3-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 25g, 100mg.
2-chloro-6-methyl-3-(trifluoromethyl)pyridine (CAS 1099597-74-6) is a chemical compound with the molecular formula C7H5ClF3N and a molecular weight of 195.57 g/mol. IUPAC name: 2-chloro-6-methyl-3-(trifluoromethyl)pyridine. InChIKey: DIFCQOVMVHCCHY-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3N |
|---|---|
| Molecular weight | 195.57 g/mol |
| IUPAC name | 2-chloro-6-methyl-3-(trifluoromethyl)pyridine |
| InChIKey | DIFCQOVMVHCCHY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)