cas: 1070663-78-3 — see every product listed under this CAS number, including other names
2-(Dicyclohexylphosphino)3,6-dimethoxy-2′,4′,6′-triisopropyl-1,1′-biphenyl, 98%, 98% (CAS 1070663-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 50g, 100g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143VF-250mg |
| cas | 1070663-78-3 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 294.80 Pln | |
| Chemat | 25g | 578.00 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1994.00 Pln | |
| Chemat | 250g | 4610.00 Pln | |
| Chemat | 1kg | 9770.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CAS 1070663-78-3) is a chemical compound with the molecular formula C35H53O2P and a molecular weight of 536.8 g/mol. IUPAC name: dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane. InChIKey: WDVGNXKCFBOKDF-UHFFFAOYSA-N.
| Molecular formula | C35H53O2P |
|---|---|
| Molecular weight | 536.8 g/mol |
| IUPAC name | dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| InChIKey | WDVGNXKCFBOKDF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2P(C3CCCCC3)C4CCCCC4)OC)OC)C(C)C |
Computed by PubChem (NCBI)