cas: 1070663-78-3 — see every product listed under this CAS number, including other names
BrettPhos, 97% (CAS 1070663-78-3) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A113556-1kg |
| cas | 1070663-78-3 |
| size | 1kg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1kg | 22865.12 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 25g | 998.94 Pln | |
| Ambeed | 100g | 3630.00 Pln | |
| Ambeed | 500g | 14315.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane (CAS 1070663-78-3) is a chemical compound with the molecular formula C35H53O2P and a molecular weight of 536.8 g/mol. IUPAC name: dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane. InChIKey: WDVGNXKCFBOKDF-UHFFFAOYSA-N.
| Molecular formula | C35H53O2P |
|---|---|
| Molecular weight | 536.8 g/mol |
| IUPAC name | dicyclohexyl-[3,6-dimethoxy-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| InChIKey | WDVGNXKCFBOKDF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=C(C=CC(=C2P(C3CCCCC3)C4CCCCC4)OC)OC)C(C)C |
Computed by PubChem (NCBI)