2-(Dimethoxymethyl)naphthalene, 98%
cas: 77196-31-7 — see every product listed under this CAS number, including other names
2-(Dimethoxymethyl)naphthalene, 98% (CAS 77196-31-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1930813-1g |
| cas | 77196-31-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 509.44 Pln | |
| Ambeed | 25g | 1599.69 Pln | |
| Ambeed | 100g | 4965.00 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 582.80 Pln | |
| Chemat | 100g | 4787.60 Pln | |
| BLDpharm | 1g | 197.73 Pln | |
| BLDpharm | 5g | 497.63 Pln | |
| BLDpharm | 25g | 1563.92 Pln | |
| BLDpharm | 100g | 4857.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(dimethoxymethyl)naphthalene (CAS 77196-31-7) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: 2-(dimethoxymethyl)naphthalene. InChIKey: DUWXVMIEMVFNGD-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 2-(dimethoxymethyl)naphthalene |
| InChIKey | DUWXVMIEMVFNGD-UHFFFAOYSA-N |
| SMILES | COC(C1=CC2=CC=CC=C2C=C1)OC |
Computed by PubChem (NCBI)