CAS 21779-31-7 appears in our catalog under these names: Ethyl 2-[(1e)-2,3-dihydro-1h-inden-1-ylidene]acetate, 95%, Ethyl 2-((1E)-2,3-dihydro-1H-inden-1-ylidene)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Ethyl (2E)-2-(2,3-dihydroinden-1-ylidene)acetate (CAS 21779-31-7) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: ethyl (2E)-2-(2,3-dihydroinden-1-ylidene)acetate. InChIKey: KRGWQDMTJGWQFM-PKNBQFBNSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | ethyl (2E)-2-(2,3-dihydroinden-1-ylidene)acetate |
| InChIKey | KRGWQDMTJGWQFM-PKNBQFBNSA-N |
| SMILES | CCOC(=O)/C=C/1\CCC2=CC=CC=C21 |
Computed by PubChem (NCBI)