2-(Diphenylphosphino)-N,N-dimethylaniline, 97%
cas: 4358-50-3 — see every product listed under this CAS number, including other names
2-(Diphenylphosphino)-N,N-dimethylaniline, 97% (CAS 4358-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A531722-100mg |
| cas | 4358-50-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 559.50 Pln | |
| Ambeed | 1g | 1293.75 Pln | |
| Ambeed | 5g | 4959.44 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 798.80 Pln | |
| BLDpharm | 100mg | 331.02 Pln | |
| BLDpharm | 250mg | 603.15 Pln | |
| BLDpharm | 1g | 1386.20 Pln | |
| BLDpharm | 5g | 5340.37 Pln | |
| Fluorochem | 250mg | 653.95 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-diphenylphosphanyl-N,N-dimethylaniline (CAS 4358-50-3) is a chemical compound with the molecular formula C20H20NP and a molecular weight of 305.4 g/mol. IUPAC name: 2-diphenylphosphanyl-N,N-dimethylaniline. InChIKey: LRZUEXVJCUCZCM-UHFFFAOYSA-N.
| Molecular formula | C20H20NP |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-diphenylphosphanyl-N,N-dimethylaniline |
| InChIKey | LRZUEXVJCUCZCM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Benzenamine, 2-(diphenylphosphino)-N,N-dimethyl-, 2-(diphenylphosphino)-N,N-dimethylaniline, 2-diphenylphosphanyl-N,N-dimethyl-aniline, 2-(Diphenylphosphino)-NN-dimethylaniline, 2-diphenylphosphanyl-N,N-dimethylaniline, DiphenyL(2-dimethylaminophenyl)-phosphin, 2-(diphenylphosphaneyl)-N,N-dimethylaniline