Products 4358-50-3

CAS 4358-50-3 is the registry number for 2-(Diphenylphosphino)-N,N-dimethylaniline, 97%, 97%. Offered by: Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-diphenylphosphanyl-N,N-dimethylaniline (CAS 4358-50-3) is a chemical compound with the molecular formula C20H20NP and a molecular weight of 305.4 g/mol. IUPAC name: 2-diphenylphosphanyl-N,N-dimethylaniline. InChIKey: LRZUEXVJCUCZCM-UHFFFAOYSA-N.

Identity
Molecular formulaC20H20NP
Molecular weight305.4 g/mol
IUPAC name2-diphenylphosphanyl-N,N-dimethylaniline
InChIKeyLRZUEXVJCUCZCM-UHFFFAOYSA-N
SMILESCN(C)C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)