Products 65399-12-4
CAS 65399-12-4 appears in our catalog under these names: 2-(HYDROXYMETHYL)-4-METHOXYBENZOIC ACID, ≥97%, 2-(Hydroxymethyl)-4-methoxybenzoic Acid, ≥97%, ≥97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
2-(hydroxymethyl)-4-methoxybenzoic acid (CAS 65399-12-4) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2-(hydroxymethyl)-4-methoxybenzoic acid. InChIKey: CMVVYUFZVXYPLT-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2-(hydroxymethyl)-4-methoxybenzoic acid |
| InChIKey | CMVVYUFZVXYPLT-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)O)CO |
Computed by PubChem (NCBI)