CAS 10538-47-3 appears in our catalog under these names: Benzenepropanoic acid, 2,5-dihydroxy-, 95%, (2,5-Dihydroxyphenyl)propionic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 500mg, 1000mg, 2000mg.
3-(2,5-dihydroxyphenyl)propanoic acid (CAS 10538-47-3) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 3-(2,5-dihydroxyphenyl)propanoic acid. InChIKey: SQAWOFKHXXVVLM-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 3-(2,5-dihydroxyphenyl)propanoic acid |
| InChIKey | SQAWOFKHXXVVLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)CCC(=O)O)O |
Computed by PubChem (NCBI)