cas: 1814938-78-7 — see every product listed under this CAS number, including other names
2-(Methoxycarbonyl)pyrimidine-5-boronic acid, 96%, 96% (CAS 1814938-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1133X2-100mg |
| cas | 1814938-78-7 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2-methoxycarbonylpyrimidin-5-yl)boronic acid (CAS 1814938-78-7) is a chemical compound with the molecular formula C6H7BN2O4 and a molecular weight of 181.94 g/mol. IUPAC name: (2-methoxycarbonylpyrimidin-5-yl)boronic acid. InChIKey: QJBIYMZDLMVGCM-UHFFFAOYSA-N.
| Molecular formula | C6H7BN2O4 |
|---|---|
| Molecular weight | 181.94 g/mol |
| IUPAC name | (2-methoxycarbonylpyrimidin-5-yl)boronic acid |
| InChIKey | QJBIYMZDLMVGCM-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)