CAS 89466-05-7 appears in our catalog under these names: 3-Amino-5-nitrophenylboronic acid, 95%, (3-Amino-5-nitrophenyl)boronic acid, 95-<97%, (3-Amino-5-nitrophenyl)boronic acid, ≥97-<99%, 3-Amino-5-nitrophenylboronic Acid, (3-Amino-5-nitrophenyl)boronic acid, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 2,5g, 10g, 25g, 50g, 100mg.
(3-amino-5-nitrophenyl)boronic acid (CAS 89466-05-7) is a chemical compound with the molecular formula C6H7BN2O4 and a molecular weight of 181.94 g/mol. IUPAC name: (3-amino-5-nitrophenyl)boronic acid. InChIKey: KLVJZQJSYAKUKK-UHFFFAOYSA-N.
| Molecular formula | C6H7BN2O4 |
|---|---|
| Molecular weight | 181.94 g/mol |
| IUPAC name | (3-amino-5-nitrophenyl)boronic acid |
| InChIKey | KLVJZQJSYAKUKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])N)(O)O |
Computed by PubChem (NCBI)