cas: 497159-91-8 — see every product listed under this CAS number, including other names
2-(N,N- di-tert-butoxycarbonylamino) -3- methyl -5- bromopyridine, 95%, 95% (CAS 497159-91-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKL5-100mg |
| cas | 497159-91-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 635.60 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 1638.80 Pln | |
| Chemat | 5g | 4802.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-3-methyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 497159-91-8) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-(5-bromo-3-methyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: ARLXOZWDGQGERD-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-3-methyl-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | ARLXOZWDGQGERD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)