CAS 471239-60-8 appears in our catalog under these names: 1,2-Di(tert-butyloxycarbonylamino)-4-bromobenzene, 97%, Di-tert-butyl (4-bromo-1,2-phenylene)dicarbamate 97%, Di-tert-butyl (4-bromo-1,2-phenylene)dicarbamate, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 25g, 1g, 5g, 100g, 250mg.
Tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate (CAS 471239-60-8) is a chemical compound with the molecular formula C16H23BrN2O4 and a molecular weight of 387.27 g/mol. IUPAC name: tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate. InChIKey: LJKCSTXFYRULGQ-UHFFFAOYSA-N.
| Molecular formula | C16H23BrN2O4 |
|---|---|
| Molecular weight | 387.27 g/mol |
| IUPAC name | tert-butyl N-[4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]carbamate |
| InChIKey | LJKCSTXFYRULGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)