cas: 2096334-51-7 — see every product listed under this CAS number, including other names
2-(N-Butylaminomethyl)-3-chlorophenylboronic acid, pinacol ester, 98%, 98% (CAS 2096334-51-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHBL-250mg |
| cas | 2096334-51-7 |
| size | 250mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 261.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine (CAS 2096334-51-7) is a chemical compound with the molecular formula C17H27BClNO2 and a molecular weight of 323.7 g/mol. IUPAC name: N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine. InChIKey: JYAHFATXUFOJBL-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO2 |
|---|---|
| Molecular weight | 323.7 g/mol |
| IUPAC name | N-[[2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]butan-1-amine |
| InChIKey | JYAHFATXUFOJBL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)CNCCCC |
Computed by PubChem (NCBI)