CAS 2724208-31-3 is the registry number for 1-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride (CAS 2724208-31-3) is a chemical compound with the molecular formula C17H27BClNO2 and a molecular weight of 323.7 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride. InChIKey: LPSUXOBYELDMDE-UHFFFAOYSA-N.
| Molecular formula | C17H27BClNO2 |
|---|---|
| Molecular weight | 323.7 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidine;hydrochloride |
| InChIKey | LPSUXOBYELDMDE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCCCC3.Cl |
Computed by PubChem (NCBI)