2-(Phenylamino)phenol, 97%
cas: 644-71-3 — see every product listed under this CAS number, including other names
2-(Phenylamino)phenol, 97% (CAS 644-71-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1442214-250mg |
| cas | 644-71-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 1488.44 Pln | |
| Ambeed | 5g | 5020.62 Pln | |
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 986.00 Pln | |
| Chemat | 5g | 3294.80 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1463.95 Pln | |
| BLDpharm | 5g | 4923.85 Pln | |
| Fluorochem | 100mg | 367.60 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 1419.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-anilinophenol (CAS 644-71-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 185.22 g/mol. IUPAC name: 2-anilinophenol. InChIKey: GYVYGTTZKLHDON-UHFFFAOYSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-anilinophenol |
| InChIKey | GYVYGTTZKLHDON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2O |
Computed by PubChem (NCBI)