cas: 92151-73-0 — see every product listed under this CAS number, including other names
2-(Phenylethynyl)phenol, 95% (CAS 92151-73-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1224960-250mg |
| cas | 92151-73-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1043.44 Pln | |
| Ambeed | 1g | 2217.12 Pln | |
| Ambeed | 5g | 7145.50 Pln | |
| BLDpharm | 250mg | 1025.22 Pln | |
| BLDpharm | 1g | 2174.81 Pln | |
| BLDpharm | 5g | 7006.45 Pln | |
| Chemat | 250mg | 995.60 Pln | |
| Chemat | 1g | 2114.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-phenylethynyl)phenol (CAS 92151-73-0) is a chemical compound with the molecular formula C14H10O and a molecular weight of 194.23 g/mol. IUPAC name: 2-(2-phenylethynyl)phenol. InChIKey: PIOMIFUUXIDECW-UHFFFAOYSA-N.
| Molecular formula | C14H10O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-(2-phenylethynyl)phenol |
| InChIKey | PIOMIFUUXIDECW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC=CC=C2O |
Computed by PubChem (NCBI)