cas: 1015242-08-6 — see every product listed under this CAS number, including other names
2-(Piperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine 98% (CAS 1015242-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1638901-250mg |
| cas | 1015242-08-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1638901 |
2-piperidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (CAS 1015242-08-6) is a chemical compound with the molecular formula C15H24BN3O2 and a molecular weight of 289.18 g/mol. IUPAC name: 2-piperidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine. InChIKey: PHVGYFSOPFMYPH-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O2 |
|---|---|
| Molecular weight | 289.18 g/mol |
| IUPAC name | 2-piperidin-1-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| InChIKey | PHVGYFSOPFMYPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)N3CCCCC3 |
Computed by PubChem (NCBI)