cas: 146140-95-6 — see every product listed under this CAS number, including other names
2-(Pivalamido)phenylboronic Acid (contains varying amounts of Anhydride) (CAS 146140-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P2043-1G |
| cas | 146140-95-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 585.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
[2-(2,2-dimethylpropanoylamino)phenyl]boronic acid (CAS 146140-95-6) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid. InChIKey: MXRAJVMTCAUABO-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [2-(2,2-dimethylpropanoylamino)phenyl]boronic acid |
| InChIKey | MXRAJVMTCAUABO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)