cas: 99902-03-1 — see every product listed under this CAS number, including other names
2-(Thiophen-3-yl)benzaldehyde 95+% (CAS 99902-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A548999-100mg |
| cas | 99902-03-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 353.69 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A548999 |
2-thiophen-3-ylbenzaldehyde (CAS 99902-03-1) is a chemical compound with the molecular formula C11H8OS and a molecular weight of 188.25 g/mol. IUPAC name: 2-thiophen-3-ylbenzaldehyde. InChIKey: ICLJIEBWQYGNIU-UHFFFAOYSA-N.
| Molecular formula | C11H8OS |
|---|---|
| Molecular weight | 188.25 g/mol |
| IUPAC name | 2-thiophen-3-ylbenzaldehyde |
| InChIKey | ICLJIEBWQYGNIU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CSC=C2 |
Computed by PubChem (NCBI)