cas: 118157-00-9 — see every product listed under this CAS number, including other names
2-(Thiophen-3-yl)thiazolidine-4-carboxylic acid, 97% (CAS 118157-00-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A346958-5g |
| cas | 118157-00-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10225.60 Pln | |
| AmBeed | 10g | 15303.40 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid (CAS 118157-00-9) is a chemical compound with the molecular formula C8H9NO2S2 and a molecular weight of 215.3 g/mol. IUPAC name: 2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid. InChIKey: HFXYHJCOHIVMIH-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2S2 |
|---|---|
| Molecular weight | 215.3 g/mol |
| IUPAC name | 2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | HFXYHJCOHIVMIH-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CSC=C2)C(=O)O |
Computed by PubChem (NCBI)