CAS 923010-76-8 appears in our catalog under these names: 2-Amino-4H,5H,7H-thieno(2,3-c)thiopyran-3-carboxylic acid, 95%, 2-Amino-4H,5H,7H-thieno(2,3-c)thiopyran-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylic acid (CAS 923010-76-8) is a chemical compound with the molecular formula C8H9NO2S2 and a molecular weight of 215.3 g/mol. IUPAC name: 2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylic acid. InChIKey: KJRCJPRGCXZYII-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2S2 |
|---|---|
| Molecular weight | 215.3 g/mol |
| IUPAC name | 2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylic acid |
| InChIKey | KJRCJPRGCXZYII-UHFFFAOYSA-N |
| SMILES | C1CSCC2=C1C(=C(S2)N)C(=O)O |
Computed by PubChem (NCBI)