2-(Trifluoromethyl)benzenesulfonyl chloride 95%
cas: 776-04-5 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)benzenesulfonyl chloride 95% (CAS 776-04-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1502744-5g |
| cas | 776-04-5 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1010.06 Pln | |
| Ambeed | 500g | 3368.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1502744 |
2-(trifluoromethyl)benzenesulfonyl chloride (CAS 776-04-5) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ZIZGWNOAHUCACM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ZIZGWNOAHUCACM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(Trifluoromethyl)benzenesulfonyl chloride, 2-Trifluoromethylbenzenesulphonyl chloride, ZIZGWNOAHUCACM-UHFFFAOYSA-N, 2-(Trifluoromethyl)Benzene-1-Sulfonyl Chloride, 2-Trifluoromethylbenzenesulfonyl chloride, Benzenesulfonyl chloride, 2-(trifluoromethyl)-, o-(trifluoromethyl)benzenesulfonyl chloride, 2-(trifluoromethyl)benzenesulphonyl chloride, 2-(trifluoromethyl)-benzenesulfonyl chloride, 2-(trifluoromethyl)benzene-1-sulfonylchloride