2-(Trifluoromethyl)benzenesulfonyl chloride, 95%
cas: 776-04-5 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)benzenesulfonyl chloride, 95% (CAS 776-04-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 20g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007587-1G |
| cas | 776-04-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 20g | 237.43 Pln | |
| Fluorochem | 100g | 534.20 Pln | |
| Fluorochem | 500g | 2226.32 Pln | |
| Fluorochem | 1kg | 4137.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(trifluoromethyl)benzenesulfonyl chloride (CAS 776-04-5) is a chemical compound with the molecular formula C7H4ClF3O2S and a molecular weight of 244.62 g/mol. IUPAC name: 2-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ZIZGWNOAHUCACM-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF3O2S |
|---|---|
| Molecular weight | 244.62 g/mol |
| IUPAC name | 2-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ZIZGWNOAHUCACM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(Trifluoromethyl)benzenesulfonyl chloride, 2-Trifluoromethylbenzenesulphonyl chloride, ZIZGWNOAHUCACM-UHFFFAOYSA-N, 2-(Trifluoromethyl)Benzene-1-Sulfonyl Chloride, 2-Trifluoromethylbenzenesulfonyl chloride, Benzenesulfonyl chloride, 2-(trifluoromethyl)-, o-(trifluoromethyl)benzenesulfonyl chloride, 2-(trifluoromethyl)benzenesulphonyl chloride, 2-(trifluoromethyl)-benzenesulfonyl chloride, 2-(trifluoromethyl)benzene-1-sulfonylchloride