cas: 1218790-39-6 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)pyridine-5-boronic Acid Pinacol Ester, 95%, 95% (CAS 1218790-39-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11279O-25g |
| cas | 1218790-39-6 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4230.80 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1331.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine (CAS 1218790-39-6) is a chemical compound with the molecular formula C12H15BF3NO2 and a molecular weight of 273.06 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine. InChIKey: SOMIPHAQTXODQM-UHFFFAOYSA-N.
| Molecular formula | C12H15BF3NO2 |
|---|---|
| Molecular weight | 273.06 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)pyridine |
| InChIKey | SOMIPHAQTXODQM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)