cas: 347-55-7 — see every product listed under this CAS number, including other names
2-(Trifluoromethylthio)aniline, 98%, 98% (CAS 347-55-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I7V8-200mg |
| cas | 347-55-7 |
| size | 200mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 232.40 Pln | |
| Chemat | 1g | 563.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethylsulfanyl)aniline (CAS 347-55-7) is a chemical compound with the molecular formula C7H6F3NS and a molecular weight of 193.19 g/mol. IUPAC name: 2-(trifluoromethylsulfanyl)aniline. InChIKey: HIPLFBJHUALLRK-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NS |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | 2-(trifluoromethylsulfanyl)aniline |
| InChIKey | HIPLFBJHUALLRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SC(F)(F)F |
Computed by PubChem (NCBI)