CAS 131105-90-3 is the registry number for 2-Amino-3-(trifluoromethyl)benzenethiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-(trifluoromethyl)benzenethiol (CAS 131105-90-3) is a chemical compound with the molecular formula C7H6F3NS and a molecular weight of 193.19 g/mol. IUPAC name: 2-amino-3-(trifluoromethyl)benzenethiol. InChIKey: GYYSBWSFSDFQEN-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NS |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | 2-amino-3-(trifluoromethyl)benzenethiol |
| InChIKey | GYYSBWSFSDFQEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)S)N)C(F)(F)F |
Computed by PubChem (NCBI)