CAS 72047-94-0 appears in our catalog under these names: 2-(Trimethylsilylmethyl)allyl acetate, 94%, 2-(Trimethylsilylmethyl)allyl acetate, 95%, 2–(Trimethylsilylmethyl)allyl acetate, 2-((ACETOXYMETHYL)ALLYL)TRIMETHYLSILANE,, 2-[(Acetoxymethyl)allyl]trimethylsilane,. Offered by: Thermo Scientific (Acros), Combi-blocks, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100g, 500g.
2-(trimethylsilylmethyl)prop-2-enyl acetate (CAS 72047-94-0) is a chemical compound with the molecular formula C9H18O2Si and a molecular weight of 186.32 g/mol. IUPAC name: 2-(trimethylsilylmethyl)prop-2-enyl acetate. InChIKey: IKQWABMHZKGCLX-UHFFFAOYSA-N.
| Molecular formula | C9H18O2Si |
|---|---|
| Molecular weight | 186.32 g/mol |
| IUPAC name | 2-(trimethylsilylmethyl)prop-2-enyl acetate |
| InChIKey | IKQWABMHZKGCLX-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=C)C[Si](C)(C)C |
Computed by PubChem (NCBI)