Products 2396521-62-1

CAS 2396521-62-1 is the registry number for SILYL-ETHER BASED ROMP MONOMER, ETSI. Offered by: Sigma-Aldrich. Available pack sizes: 1G, 5G.

Structural formula: {0} (CAS {1})

2,2-diethyl-5,8-dihydro-4H-1,3,2-dioxasilocine (CAS 2396521-62-1) is a chemical compound with the molecular formula C9H18O2Si and a molecular weight of 186.32 g/mol. IUPAC name: 2,2-diethyl-5,8-dihydro-4H-1,3,2-dioxasilocine. InChIKey: VEPWFNJDVWARGY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18O2Si
Molecular weight186.32 g/mol
IUPAC name2,2-diethyl-5,8-dihydro-4H-1,3,2-dioxasilocine
InChIKeyVEPWFNJDVWARGY-UHFFFAOYSA-N
SMILESCC[Si]1(OCCC=CCO1)CC

Computed by PubChem (NCBI)