2-(Trimethylsilylmethyl)allyl acetate, 96%
cas: 72047-94-0 — see every product listed under this CAS number, including other names
2-(Trimethylsilylmethyl)allyl acetate, 96% (CAS 72047-94-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A269351-250mg |
| cas | 72047-94-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 10g | 1443.94 Pln | |
| Ambeed | 25g | 2823.44 Pln | |
| Ambeed | 100g | 8875.44 Pln | |
| Ambeed | 500g | 35291.75 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 936.36 Pln | |
| BLDpharm | 10g | 1552.81 Pln | |
| BLDpharm | 25g | 3035.62 Pln | |
| BLDpharm | 100g | 9566.66 Pln | |
| BLDpharm | 500g | 38045.52 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
2-(trimethylsilylmethyl)prop-2-enyl acetate (CAS 72047-94-0) is a chemical compound with the molecular formula C9H18O2Si and a molecular weight of 186.32 g/mol. IUPAC name: 2-(trimethylsilylmethyl)prop-2-enyl acetate. InChIKey: IKQWABMHZKGCLX-UHFFFAOYSA-N.
| Molecular formula | C9H18O2Si |
|---|---|
| Molecular weight | 186.32 g/mol |
| IUPAC name | 2-(trimethylsilylmethyl)prop-2-enyl acetate |
| InChIKey | IKQWABMHZKGCLX-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=C)C[Si](C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
2-(Trimethylsilylmethyl)allyl acetate, 2-((Trimethylsilyl)methyl)allyl acetate, 2-(trimethylsilylmethyl)prop-2-enyl Acetate, 2-[(Acetoxymethyl)allyl]trimethylsilane, 2-Acetoxymethyl-3-(trimethylsilyl)propene, 2-(Acetoxymethyl)-3-(trimethylsilyl)propene, 2-[(trimethylsilyl)methyl]prop-2-en-1-yl acetate, 2-[(Trimethylsilyl)methyl]allyl Acetate, 2-[(trimethylsilyl)methyl]-2-propen-1-yl acetate, tridecaborondiphosphide