CAS 906-65-0 appears in our catalog under these names: 2-(Triphenylphosphoranylidene)succinic anhydride, 95%, 3-(Triphenylphosphoranylidene)dihydrofuran-2,5-dione, 97%, 2-(Triphenylphosphoranylidene)succinic anhydride/ 98%, 3-(Triphenylphosphoranylidene)Dihydrofuran-2,5-Dione. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g.
3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione (CAS 906-65-0) is a chemical compound with the molecular formula C22H17O3P and a molecular weight of 360.3 g/mol. IUPAC name: 3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione. InChIKey: CXYNGWAHZKOMJQ-UHFFFAOYSA-N.
| Molecular formula | C22H17O3P |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 3-(triphenyl-lambda5-phosphanylidene)oxolane-2,5-dione |
| InChIKey | CXYNGWAHZKOMJQ-UHFFFAOYSA-N |
| SMILES | C1C(=P(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)OC1=O |
Computed by PubChem (NCBI)