cas: 92422-79-2 — see every product listed under this CAS number, including other names
2-(m-Tolyl)thiazole-4-carbaldehyde, 98%, 98% (CAS 92422-79-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1176VE-100mg |
| cas | 92422-79-2 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2603.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-methylphenyl)-1,3-thiazole-4-carbaldehyde (CAS 92422-79-2) is a chemical compound with the molecular formula C11H9NOS and a molecular weight of 203.26 g/mol. IUPAC name: 2-(3-methylphenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: FRSDKJVLVWGYEI-UHFFFAOYSA-N.
| Molecular formula | C11H9NOS |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 2-(3-methylphenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | FRSDKJVLVWGYEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)