CAS 58351-05-6 appears in our catalog under these names: 1-(4-Phenyl-1,3-thiazol-2-yl)ethanone, 95%, 1–(4–Phenyl–1,3–thiazol–2–yl)ethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-(4-phenyl-1,3-thiazol-2-yl)ethanone (CAS 58351-05-6) is a chemical compound with the molecular formula C11H9NOS and a molecular weight of 203.26 g/mol. IUPAC name: 1-(4-phenyl-1,3-thiazol-2-yl)ethanone. InChIKey: WLRIQFOJQQWQRX-UHFFFAOYSA-N.
| Molecular formula | C11H9NOS |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 1-(4-phenyl-1,3-thiazol-2-yl)ethanone |
| InChIKey | WLRIQFOJQQWQRX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CS1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)