2-(m-Tolyloxy)aniline, 95+%
cas: 60287-67-4 — see every product listed under this CAS number, including other names
2-(m-Tolyloxy)aniline, 95+% (CAS 60287-67-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, BLDpharm, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A369122-10g |
| cas | 60287-67-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10225.60 Pln | |
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 631.81 Pln | |
| Ambeed | 5g | 2300.56 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 675.34 Pln | |
| BLDpharm | 5g | 2480.26 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 3578.00 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3-methylphenoxy)aniline (CAS 60287-67-4) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: 2-(3-methylphenoxy)aniline. InChIKey: FIOLZDYDNLDKJZ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 2-(3-methylphenoxy)aniline |
| InChIKey | FIOLZDYDNLDKJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)OC2=CC=CC=C2N |
Computed by PubChem (NCBI)