CAS 1379348-30-7 appears in our catalog under these names: (3-Amino-[1,1'-biphenyl]-4-yl)methanol, 95%, (3-Amino-(1,1'-biphenyl)-4-yl)methanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2-amino-4-phenylphenyl)methanol (CAS 1379348-30-7) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. IUPAC name: (2-amino-4-phenylphenyl)methanol. InChIKey: BLSWTPAEPBXGOL-UHFFFAOYSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | (2-amino-4-phenylphenyl)methanol |
| InChIKey | BLSWTPAEPBXGOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)CO)N |
Computed by PubChem (NCBI)