cas: 1256358-89-0 — see every product listed under this CAS number, including other names
2-(tert-Butoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 1256358-89-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A590960-250mg |
| cas | 1256358-89-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1616.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A590960 |
2-[(2-methylpropan-2-yl)oxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1256358-89-0) is a chemical compound with the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: NJSUTJJMQXIVLM-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxy]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | NJSUTJJMQXIVLM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)OC(C)(C)C |
Computed by PubChem (NCBI)