cas: 1032758-88-5 — see every product listed under this CAS number, including other names
2-(tert-Butoxycarbonylamino)pyrimidine-5-boronic acid, pinacol ester 98% (CAS 1032758-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A287652-100mg |
| cas | 1032758-88-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2556.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A287652 |
Tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate (CAS 1032758-88-5) is a chemical compound with the molecular formula C15H24BN3O4 and a molecular weight of 321.18 g/mol. IUPAC name: tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate. InChIKey: XICHESWFGOSKMN-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O4 |
|---|---|
| Molecular weight | 321.18 g/mol |
| IUPAC name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]carbamate |
| InChIKey | XICHESWFGOSKMN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)