CAS 1402227-80-8 is the registry number for tert-Butyl (5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate (CAS 1402227-80-8) is a chemical compound with the molecular formula C15H24BN3O4 and a molecular weight of 321.18 g/mol. IUPAC name: tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate. InChIKey: GVFYQQHRLZTLMY-UHFFFAOYSA-N.
| Molecular formula | C15H24BN3O4 |
|---|---|
| Molecular weight | 321.18 g/mol |
| IUPAC name | tert-butyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate |
| InChIKey | GVFYQQHRLZTLMY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=N2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)