cas: 13395-85-2 — see every product listed under this CAS number, including other names
2-(tert-Butyl)-4-chlorophenol (CAS 13395-85-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F226721-100MG |
| cas | 13395-85-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 940.31 Pln | |
| Fluorochem | 5g | 3538.36 Pln |
| delivery time | 3-4 weeks |
|---|
2-tert-butyl-4-chlorophenol (CAS 13395-85-2) is a chemical compound with the molecular formula C10H13ClO and a molecular weight of 184.66 g/mol. IUPAC name: 2-tert-butyl-4-chlorophenol. InChIKey: YLSXYZWJAZVUBD-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO |
|---|---|
| Molecular weight | 184.66 g/mol |
| IUPAC name | 2-tert-butyl-4-chlorophenol |
| InChIKey | YLSXYZWJAZVUBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)